About CID 58571114
CID 58571114 (PubChem CID 58571114) has the molecular formula C31H50N5O4S2Si2
and a molecular weight of 677.08 g/mol.
Molecular Properties
| Compound Name | CID 58571114 |
| PubChem CID | 58571114 |
| Molecular Formula | C31H50N5O4S2Si2 |
| Molecular Weight | 677.08 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | — |
| SMILES | CSc1nc(C)c(-c2nc3cnccc3s2)c(N[C@@H]2C[C@H](CO[Si](O[Si](C(C)C)C(C)C)(C(C)C)C(C)C)[C@@H](O)[C@@]2(C)O)n1 |
| InChI | InChI=1S/C31H50N5O4S2Si2/c1-17(2)43(18(3)4)40-44(19(5)6,20(7)8)39-16-22-14-25(31(10,38)27(22)37)35-28-26(21(9)33-30(36-28)41-11)29-34-23-15-32-13-12-24(23)42-29/h12-13,15,17-20,22,25,27,37-38H,14,16H2,1-11H3,(H,33,35,36)/t22-,25-,27-,31+/m1/s1 |
| InChIKey | HZVKPFBDIBAEIB-ZDMNVVTDSA-N |
| XLogP | 7.20 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 677.08 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58571114 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58571114?
The IUPAC name of CID 58571114 (CID 58571114) is not available.
What is the SMILES notation for CID 58571114?
The canonical SMILES for CID 58571114 is CSc1nc(C)c(-c2nc3cnccc3s2)c(N[C@@H]2C[C@H](CO[Si](O[Si](C(C)C)C(C)C)(C(C)C)C(C)C)[C@@H](O)[C@@]2(C)O)n1.
What is the InChIKey of CID 58571114?
The InChIKey is HZVKPFBDIBAEIB-ZDMNVVTDSA-N. The full InChI is InChI=1S/C31H50N5O4S2Si2/c1-17(2)43(18(3)4)40-44(19(5)6,20(7)8)39-16-22-14-25(31(10,38)27(22)37)35-28-26(21(9)33-30(36-28)41-11)29-34-23-15-32-13-12-24(23)42-29/h12-13,15,17-20,22,25,27,37-38H,14,16H2,1-11H3,(H,33,35,36)/t22-,25-,27-,31+/m1/s1.
What are the key properties of CID 58571114?
CID 58571114 has a molecular weight of 677.08 g/mol, XLogP of 7.20, 13 rotatable bonds, 3 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58571114 is sourced from PubChem (CID 58571114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).