C13H16ClN5O3S — CID 58571128
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(1,3-thiazol-5-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 58571128) has the molecular formula C13H16ClN5O3S and a molecular weight of 357.82 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(1,3-thiazol-5-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(1,3-thiazol-5-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58571128 |
| Molecular Formula | C13H16ClN5O3S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(1,3-thiazol-5-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Nc1nc(Cl)c(-c2cncs2)c(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C13H16ClN5O3S/c14-11-8(7-2-16-4-23-7)12(19-13(15)18-11)17-6-1-5(3-20)9(21)10(6)22/h2,4-6,9-10,20-22H,1,3H2,(H3,15,17,18,19)/t5-,6-,9-,10+/m1/s1 |
| InChIKey | ZCRPGJFUSUXTBL-QLSQZMLOSA-N |
| XLogP | 0.35 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |