(2R)-2-amino-2-methyldec-9-enoic acid

C11H21NO2 — CID 58571232

IUPAC(2R)-2-amino-2-methyldec-9-enoic acid
SMILESC=CCCCCCC[C@@](C)(N)C(=O)O
InChIInChI=1S/C11H21NO2/c1-3-4-5-6-7-8-9-11(2,12)10(13)14/h3H,1,4-9,12H2,2H3,(H,13,14)/t11-/m1/s1
InChIKeyJWZFECWHKQLRGK-LLVKDONJSA-N
MW199.29 g/mol
LogP2.32
Rot. Bonds8

About (2R)-2-amino-2-methyldec-9-enoic acid

(2R)-2-amino-2-methyldec-9-enoic acid (PubChem CID 58571232) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (2R)-2-amino-2-methyldec-9-enoic acid.

Molecular Properties

Compound Name(2R)-2-amino-2-methyldec-9-enoic acid
PubChem CID58571232
Molecular FormulaC11H21NO2
Molecular Weight199.29 g/mol
Exact Mass199.16
IUPAC Name(2R)-2-amino-2-methyldec-9-enoic acid
SMILESC=CCCCCCC[C@@](C)(N)C(=O)O
InChIInChI=1S/C11H21NO2/c1-3-4-5-6-7-8-9-11(2,12)10(13)14/h3H,1,4-9,12H2,2H3,(H,13,14)/t11-/m1/s1
InChIKeyJWZFECWHKQLRGK-LLVKDONJSA-N
XLogP2.32
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.29
LogP ≤ 52.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (2R)-2-amino-2-methyldec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-Methyl-2-amino-undecanoic acid
CID 232320
(s)-2-Amino-2-methylhept-6-enoic acid
CID 16043571
2-Amino-2-methylnonanoic acid
CID 232322
2-Amino-2-methyloctanoic acid
CID 232321
2-Amino-2-methyldodec-11-enoic acid
CID 233531
(2S)-2-Amino-2-methyloctanoic acid
CID 11332749
(2S)-2-amino-2-methylundecanoic acid
CID 11390280
2-Methyl-2-aminodecanoic acid
CID 13956159
alpha-Nonylalanine
CID 13956162
Lauryl aminopropionic acid
CID 22665190
(R)-2-amino-2-methylhept-6-enoic acid
CID 58571237
2,2-Bis(4-pentenyl)glycine
CID 87318887

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-2-methyldec-9-enoic acid?
The IUPAC name of (2R)-2-amino-2-methyldec-9-enoic acid (CID 58571232) is (2R)-2-amino-2-methyldec-9-enoic acid.
What is the SMILES notation for (2R)-2-amino-2-methyldec-9-enoic acid?
The canonical SMILES for (2R)-2-amino-2-methyldec-9-enoic acid is C=CCCCCCC[C@@](C)(N)C(=O)O.
What is the InChIKey of (2R)-2-amino-2-methyldec-9-enoic acid?
The InChIKey is JWZFECWHKQLRGK-LLVKDONJSA-N. The full InChI is InChI=1S/C11H21NO2/c1-3-4-5-6-7-8-9-11(2,12)10(13)14/h3H,1,4-9,12H2,2H3,(H,13,14)/t11-/m1/s1.
What are the key properties of (2R)-2-amino-2-methyldec-9-enoic acid?
(2R)-2-amino-2-methyldec-9-enoic acid has a molecular weight of 199.29 g/mol, XLogP of 2.32, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-methyldec-9-enoic acid is sourced from PubChem (CID 58571232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).