C16H27F3N2O3 — CID 58571250
N-(5-methyl-6-oxoheptyl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide (PubChem CID 58571250) has the molecular formula C16H27F3N2O3 and a molecular weight of 352.40 g/mol. Its IUPAC name is N-(5-methyl-6-oxoheptyl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide.
| Compound Name | N-(5-methyl-6-oxoheptyl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 58571250 |
| Molecular Formula | C16H27F3N2O3 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-(5-methyl-6-oxoheptyl)-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
| SMILES | CC(=O)C(C)CCCCNC(=O)CCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H27F3N2O3/c1-12(13(2)22)8-5-7-10-20-14(23)9-4-3-6-11-21-15(24)16(17,18)19/h12H,3-11H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | WJLRSNNJVNNSAG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|