About 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol
2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol (PubChem CID 58571261) has the molecular formula C19H22O3
and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol.
Molecular Properties
| Compound Name | 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol |
| PubChem CID | 58571261 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol |
| SMILES | Cc1ccc2c(c1)OC(CCc1ccc(OCCO)cc1)C2 |
| InChI | InChI=1S/C19H22O3/c1-14-2-6-16-13-18(22-19(16)12-14)9-5-15-3-7-17(8-4-15)21-11-10-20/h2-4,6-8,12,18,20H,5,9-11,13H2,1H3 |
| InChIKey | TWUKODWSIDEPQR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol?
The IUPAC name of 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol (CID 58571261) is 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol.
What is the SMILES notation for 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol?
The canonical SMILES for 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol is Cc1ccc2c(c1)OC(CCc1ccc(OCCO)cc1)C2.
What is the InChIKey of 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol?
The InChIKey is TWUKODWSIDEPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3/c1-14-2-6-16-13-18(22-19(16)12-14)9-5-15-3-7-17(8-4-15)21-11-10-20/h2-4,6-8,12,18,20H,5,9-11,13H2,1H3.
What are the key properties of 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol?
2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol has a molecular weight of 298.38 g/mol, XLogP of 3.30, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(6-methyl-2,3-dihydro-1-benzofuran-2-yl)ethyl]phenoxy]ethanol is sourced from PubChem (CID 58571261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).