C14H25F2NO4 — CID 58571383
[2,2-difluoro-1-(3-hydroxypropylamino)-1-oxopentan-3-yl] 2,2-dimethylbutanoate (PubChem CID 58571383) has the molecular formula C14H25F2NO4 and a molecular weight of 309.35 g/mol. Its IUPAC name is [2,2-difluoro-1-(3-hydroxypropylamino)-1-oxopentan-3-yl] 2,2-dimethylbutanoate.
| Compound Name | [2,2-difluoro-1-(3-hydroxypropylamino)-1-oxopentan-3-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58571383 |
| Molecular Formula | C14H25F2NO4 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | [2,2-difluoro-1-(3-hydroxypropylamino)-1-oxopentan-3-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(OC(=O)C(C)(C)CC)C(F)(F)C(=O)NCCCO |
| InChI | InChI=1S/C14H25F2NO4/c1-5-10(21-12(20)13(3,4)6-2)14(15,16)11(19)17-8-7-9-18/h10,18H,5-9H2,1-4H3,(H,17,19) |
| InChIKey | RTKXGXJGFIXRFG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|