C19H22F6O6 — CID 58571448
[6-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2,2-dimethylbutanoate (PubChem CID 58571448) has the molecular formula C19H22F6O6 and a molecular weight of 460.37 g/mol. Its IUPAC name is [6-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [6-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58571448 |
| Molecular Formula | C19H22F6O6 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [6-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C2CC3C1OC(=O)C3(CC(=O)OC(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C19H22F6O6/c1-4-16(2,3)14(27)30-11-8-5-9-12(11)31-15(28)17(9,6-8)7-10(26)29-13(18(20,21)22)19(23,24)25/h8-9,11-13H,4-7H2,1-3H3 |
| InChIKey | MPIDRGNBWBSURW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|