C17H18F6O7 — CID 58571455
1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58571455) has the molecular formula C17H18F6O7 and a molecular weight of 448.31 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58571455 |
| Molecular Formula | C17H18F6O7 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1C2OC(=O)C3C2OC1C3C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H18F6O7/c1-4-15(2,3)14(26)29-10-8-6(5-7(27-8)9(10)28-11(5)24)12(25)30-13(16(18,19)20)17(21,22)23/h5-10,13H,4H2,1-3H3 |
| InChIKey | ANLGPOFFQAYWRL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|