C23H22F9NO12S4 — CID 58571924
2-(4-butan-2-ylphenoxy)sulfonylethyl 4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate (PubChem CID 58571924) has the molecular formula C23H22F9NO12S4 and a molecular weight of 803.67 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenoxy)sulfonylethyl 4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate.
| Compound Name | 2-(4-butan-2-ylphenoxy)sulfonylethyl 4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate |
|---|---|
| PubChem CID | 58571924 |
| Molecular Formula | C23H22F9NO12S4 |
| Molecular Weight | 803.67 g/mol |
| Exact Mass | 802.99 |
| IUPAC Name | 2-(4-butan-2-ylphenoxy)sulfonylethyl 4-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxybenzoate |
| SMILES | CCC(C)c1ccc(OS(=O)(=O)CCOC(=O)c2ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H22F9NO12S4/c1-3-14(2)15-4-8-17(9-5-15)44-46(35,36)13-12-43-19(34)16-6-10-18(11-7-16)45-49(41,42)22(28,29)20(24,25)21(26,27)47(37,38)33-48(39,40)23(30,31)32/h4-11,14,33H,3,12-13H2,1-2H3 |
| InChIKey | FJRKOCIXEJTBHH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 193.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.67 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|