About (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate
(6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate (PubChem CID 58571928) has the molecular formula C16H19NO6
and a molecular weight of 321.33 g/mol. Its IUPAC name is (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate |
| PubChem CID | 58571928 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(=O)OC1C2CC3C1OC(=O)C3(C#N)C2 |
| InChI | InChI=1S/C16H19NO6/c1-4-15(2,3)12(18)23-14(20)22-10-8-5-9-11(10)21-13(19)16(9,6-8)7-17/h8-11H,4-6H2,1-3H3 |
| InChIKey | VMMJKZCHAWZTFI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate?
The IUPAC name of (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate (CID 58571928) is (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate.
What is the SMILES notation for (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate?
The canonical SMILES for (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC(=O)OC1C2CC3C1OC(=O)C3(C#N)C2.
What is the InChIKey of (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate?
The InChIKey is VMMJKZCHAWZTFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO6/c1-4-15(2,3)12(18)23-14(20)22-10-8-5-9-11(10)21-13(19)16(9,6-8)7-17/h8-11H,4-6H2,1-3H3.
What are the key properties of (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate?
(6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate has a molecular weight of 321.33 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxycarbonyl 2,2-dimethylbutanoate is sourced from PubChem (CID 58571928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).