C27H25F2NO10 — CID 58571987
(2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-6,8-difluoro-4-methyl-2-oxochromen-3-yl]furan-2-yl]hexanoate (PubChem CID 58571987) has the molecular formula C27H25F2NO10 and a molecular weight of 561.49 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-6,8-difluoro-4-methyl-2-oxochromen-3-yl]furan-2-yl]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-6,8-difluoro-4-methyl-2-oxochromen-3-yl]furan-2-yl]hexanoate |
|---|---|
| PubChem CID | 58571987 |
| Molecular Formula | C27H25F2NO10 |
| Molecular Weight | 561.49 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-6,8-difluoro-4-methyl-2-oxochromen-3-yl]furan-2-yl]hexanoate |
| SMILES | CC(=O)OCOc1c(F)cc2c(C)c(-c3ccc(CCCCCC(=O)ON4C(=O)CCC4=O)o3)c(=O)oc2c1F |
| InChI | InChI=1S/C27H25F2NO10/c1-14-17-12-18(28)26(37-13-36-15(2)31)24(29)25(17)39-27(35)23(14)19-9-8-16(38-19)6-4-3-5-7-22(34)40-30-20(32)10-11-21(30)33/h8-9,12H,3-7,10-11,13H2,1-2H3 |
| InChIKey | BZUJCVGUMPBDJO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 142.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|