C36H45N9O5 — CID 58572133
5-[[5-acetamido-2-benzyl-6-(1H-imidazol-5-yl)-4-oxohexanoyl]amino]-8-(diaminomethylideneamino)-2-(1H-indol-3-ylmethyl)-4-oxooctanamide (PubChem CID 58572133) has the molecular formula C36H45N9O5 and a molecular weight of 683.81 g/mol. Its IUPAC name is 5-[[5-acetamido-2-benzyl-6-(1H-imidazol-5-yl)-4-oxohexanoyl]amino]-8-(diaminomethylideneamino)-2-(1H-indol-3-ylmethyl)-4-oxooctanamide.
| Compound Name | 5-[[5-acetamido-2-benzyl-6-(1H-imidazol-5-yl)-4-oxohexanoyl]amino]-8-(diaminomethylideneamino)-2-(1H-indol-3-ylmethyl)-4-oxooctanamide |
|---|---|
| PubChem CID | 58572133 |
| Molecular Formula | C36H45N9O5 |
| Molecular Weight | 683.81 g/mol |
| Exact Mass | 683.35 |
| IUPAC Name | 5-[[5-acetamido-2-benzyl-6-(1H-imidazol-5-yl)-4-oxohexanoyl]amino]-8-(diaminomethylideneamino)-2-(1H-indol-3-ylmethyl)-4-oxooctanamide |
| SMILES | CC(=O)NC(Cc1cnc[nH]1)C(=O)CC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)CC(Cc1c[nH]c2ccccc12)C(N)=O |
| InChI | InChI=1S/C36H45N9O5/c1-22(46)44-31(18-27-20-40-21-43-27)33(48)17-25(14-23-8-3-2-4-9-23)35(50)45-30(12-7-13-41-36(38)39)32(47)16-24(34(37)49)15-26-19-42-29-11-6-5-10-28(26)29/h2-6,8-11,19-21,24-25,30-31,42H,7,12-18H2,1H3,(H2,37,49)(H,40,43)(H,44,46)(H,45,50)(H4,38,39,41) |
| InChIKey | ZUCYDKBNJUFIGC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 244.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.81 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|