C11H11BrF2O2 — CID 58572556
(2R)-2-[1-(6-bromo-2,3-difluorophenyl)ethoxymethyl]oxirane (PubChem CID 58572556) has the molecular formula C11H11BrF2O2 and a molecular weight of 293.11 g/mol. Its IUPAC name is (2R)-2-[1-(6-bromo-2,3-difluorophenyl)ethoxymethyl]oxirane.
| Compound Name | (2R)-2-[1-(6-bromo-2,3-difluorophenyl)ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 58572556 |
| Molecular Formula | C11H11BrF2O2 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | (2R)-2-[1-(6-bromo-2,3-difluorophenyl)ethoxymethyl]oxirane |
| SMILES | CC(OC[C@H]1CO1)c1c(Br)ccc(F)c1F |
| InChI | InChI=1S/C11H11BrF2O2/c1-6(15-4-7-5-16-7)10-8(12)2-3-9(13)11(10)14/h2-3,6-7H,4-5H2,1H3/t6?,7-/m0/s1 |
| InChIKey | DBNPFLFELLYUMX-MLWJPKLSSA-N |
| XLogP | 3.20 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|