About 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane
2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane (PubChem CID 58572708) has the molecular formula C12H13ClF2O2
and a molecular weight of 262.68 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane.
Molecular Properties
| Compound Name | 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane |
| PubChem CID | 58572708 |
| Molecular Formula | C12H13ClF2O2 |
| Molecular Weight | 262.68 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane |
| SMILES | CC[C@@H](OCC1CO1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H13ClF2O2/c1-2-12(17-6-7-5-16-7)8-3-10(14)11(15)4-9(8)13/h3-4,7,12H,2,5-6H2,1H3/t7?,12-/m1/s1 |
| InChIKey | MULYPQSRAPZVRV-RKSKCOGQSA-N |
| XLogP | 3.48 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane?
The IUPAC name of 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane (CID 58572708) is 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane.
What is the SMILES notation for 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane?
The canonical SMILES for 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane is CC[C@@H](OCC1CO1)c1cc(F)c(F)cc1Cl.
What is the InChIKey of 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane?
The InChIKey is MULYPQSRAPZVRV-RKSKCOGQSA-N. The full InChI is InChI=1S/C12H13ClF2O2/c1-2-12(17-6-7-5-16-7)8-3-10(14)11(15)4-9(8)13/h3-4,7,12H,2,5-6H2,1H3/t7?,12-/m1/s1.
What are the key properties of 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane?
2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane has a molecular weight of 262.68 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R)-1-(2-chloro-4,5-difluorophenyl)propoxy]methyl]oxirane is sourced from PubChem (CID 58572708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).