C15H23KN- — CID 58573179
potassium 2-(3-methanidyl-2,2,4,4-tetramethylpentan-3-yl)-3H-pyridin-3-ide (PubChem CID 58573179) has the molecular formula C15H23KN- and a molecular weight of 256.45 g/mol. Its IUPAC name is potassium 2-(3-methanidyl-2,2,4,4-tetramethylpentan-3-yl)-3H-pyridin-3-ide.
| Compound Name | potassium 2-(3-methanidyl-2,2,4,4-tetramethylpentan-3-yl)-3H-pyridin-3-ide |
|---|---|
| PubChem CID | 58573179 |
| Molecular Formula | C15H23KN- |
| Molecular Weight | 256.45 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | potassium 2-(3-methanidyl-2,2,4,4-tetramethylpentan-3-yl)-3H-pyridin-3-ide |
| SMILES | [CH2-]C(c1[c-]cccn1)(C(C)(C)C)C(C)(C)C.[K+] |
| InChI | InChI=1S/C15H23N.K/c1-13(2,3)15(7,14(4,5)6)12-10-8-9-11-16-12;/h8-9,11H,7H2,1-6H3;/q-2;+1 |
| InChIKey | VZGJDTMKALPODX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|