About (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane
(3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane (PubChem CID 58573491) has the molecular formula C11H24O2S
and a molecular weight of 220.38 g/mol. Its IUPAC name is (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane.
Molecular Properties
| Compound Name | (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane |
| PubChem CID | 58573491 |
| Molecular Formula | C11H24O2S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane |
| SMILES | CC[C@@H](CS(=O)(=O)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24O2S/c1-7-10(11(4,5)6)8-14(12,13)9(2)3/h9-10H,7-8H2,1-6H3/t10-/m0/s1 |
| InChIKey | NQIDADZHQYTQDG-JTQLQIEISA-N |
| XLogP | 2.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane?
The IUPAC name of (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane (CID 58573491) is (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane.
What is the SMILES notation for (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane?
The canonical SMILES for (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane is CC[C@@H](CS(=O)(=O)C(C)C)C(C)(C)C.
What is the InChIKey of (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane?
The InChIKey is NQIDADZHQYTQDG-JTQLQIEISA-N. The full InChI is InChI=1S/C11H24O2S/c1-7-10(11(4,5)6)8-14(12,13)9(2)3/h9-10H,7-8H2,1-6H3/t10-/m0/s1.
What are the key properties of (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane?
(3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane has a molecular weight of 220.38 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,2-dimethyl-3-(propan-2-ylsulfonylmethyl)pentane is sourced from PubChem (CID 58573491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).