About 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole
2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole (PubChem CID 58573775) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole.
Molecular Properties
| Compound Name | 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole |
| PubChem CID | 58573775 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole |
| SMILES | C=S1CC(C(C)C)=NO1 |
| InChI | InChI=1S/C6H11NOS/c1-5(2)6-4-9(3)8-7-6/h5H,3-4H2,1-2H3 |
| InChIKey | PTYIUVUADBLKLW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole?
The IUPAC name of 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole (CID 58573775) is 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole.
What is the SMILES notation for 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole?
The canonical SMILES for 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole is C=S1CC(C(C)C)=NO1.
What is the InChIKey of 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole?
The InChIKey is PTYIUVUADBLKLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c1-5(2)6-4-9(3)8-7-6/h5H,3-4H2,1-2H3.
What are the key properties of 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole?
2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole has a molecular weight of 145.23 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-4-propan-2-yl-3H-1,2,5-oxathiazole is sourced from PubChem (CID 58573775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).