C16H19N3OSi — CID 58574262
9-(2-trimethylsilylethynyl)-1,2,3,4-tetrahydropyrazino[2,1-b]quinazolin-6-one (PubChem CID 58574262) has the molecular formula C16H19N3OSi and a molecular weight of 297.43 g/mol. Its IUPAC name is 9-(2-trimethylsilylethynyl)-1,2,3,4-tetrahydropyrazino[2,1-b]quinazolin-6-one.
| Compound Name | 9-(2-trimethylsilylethynyl)-1,2,3,4-tetrahydropyrazino[2,1-b]quinazolin-6-one |
|---|---|
| PubChem CID | 58574262 |
| Molecular Formula | C16H19N3OSi |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 9-(2-trimethylsilylethynyl)-1,2,3,4-tetrahydropyrazino[2,1-b]quinazolin-6-one |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(=O)n3c(nc2c1)CNCC3 |
| InChI | InChI=1S/C16H19N3OSi/c1-21(2,3)9-6-12-4-5-13-14(10-12)18-15-11-17-7-8-19(15)16(13)20/h4-5,10,17H,7-8,11H2,1-3H3 |
| InChIKey | AGXLHYYQGRUHDK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|