About 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one
8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 58574350) has the molecular formula C9H7BrN2O
and a molecular weight of 239.07 g/mol. Its IUPAC name is 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 58574350 |
| Molecular Formula | C9H7BrN2O |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cnc2cc(Br)ccn2c1=O |
| InChI | InChI=1S/C9H7BrN2O/c1-6-5-11-8-4-7(10)2-3-12(8)9(6)13/h2-5H,1H3 |
| InChIKey | FOIMFXFYGBFUEU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one (CID 58574350) is 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one is Cc1cnc2cc(Br)ccn2c1=O.
What is the InChIKey of 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one?
The InChIKey is FOIMFXFYGBFUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2O/c1-6-5-11-8-4-7(10)2-3-12(8)9(6)13/h2-5H,1H3.
What are the key properties of 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one?
8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one has a molecular weight of 239.07 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3-methylpyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 58574350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).