C15H15ClN2O2 — CID 58574486
13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carbonyl chloride (PubChem CID 58574486) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is 13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carbonyl chloride.
| Compound Name | 13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carbonyl chloride |
|---|---|
| PubChem CID | 58574486 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2c(=O)n3c(nc2c1)CCCCCC3 |
| InChI | InChI=1S/C15H15ClN2O2/c16-14(19)10-6-7-11-12(9-10)17-13-5-3-1-2-4-8-18(13)15(11)20/h6-7,9H,1-5,8H2 |
| InChIKey | ANAOKKDARJTKAA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|