C23H22N2O — CID 58574774
5-[2-(4-methylphenyl)ethynyl]-2,8-diazatricyclo[8.6.0.03,8]hexadeca-1(10),2,4,6-tetraen-9-one (PubChem CID 58574774) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 5-[2-(4-methylphenyl)ethynyl]-2,8-diazatricyclo[8.6.0.03,8]hexadeca-1(10),2,4,6-tetraen-9-one.
| Compound Name | 5-[2-(4-methylphenyl)ethynyl]-2,8-diazatricyclo[8.6.0.03,8]hexadeca-1(10),2,4,6-tetraen-9-one |
|---|---|
| PubChem CID | 58574774 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 5-[2-(4-methylphenyl)ethynyl]-2,8-diazatricyclo[8.6.0.03,8]hexadeca-1(10),2,4,6-tetraen-9-one |
| SMILES | Cc1ccc(C#Cc2ccn3c(=O)c4c(nc3c2)CCCCCC4)cc1 |
| InChI | InChI=1S/C23H22N2O/c1-17-8-10-18(11-9-17)12-13-19-14-15-25-22(16-19)24-21-7-5-3-2-4-6-20(21)23(25)26/h8-11,14-16H,2-7H2,1H3 |
| InChIKey | VXYQCYVGDIPMTE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|