C29H29N5O3 — CID 58575316
8-methyl-7-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1-(oxan-4-yl)-5H-imidazo[1,5-a]quinoxalin-4-one (PubChem CID 58575316) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is 8-methyl-7-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1-(oxan-4-yl)-5H-imidazo[1,5-a]quinoxalin-4-one.
| Compound Name | 8-methyl-7-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1-(oxan-4-yl)-5H-imidazo[1,5-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 58575316 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 8-methyl-7-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1-(oxan-4-yl)-5H-imidazo[1,5-a]quinoxalin-4-one |
| SMILES | Cc1cc2c(cc1C(=O)N1CCc3[nH]c4c(C)cccc4c3C1)[nH]c(=O)c1cnc(C3CCOCC3)n12 |
| InChI | InChI=1S/C29H29N5O3/c1-16-4-3-5-19-21-15-33(9-6-22(21)31-26(16)19)29(36)20-13-23-24(12-17(20)2)34-25(28(35)32-23)14-30-27(34)18-7-10-37-11-8-18/h3-5,12-14,18,31H,6-11,15H2,1-2H3,(H,32,35) |
| InChIKey | XVFBNYBDJIVCAD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|