C9H13N5 — CID 58575673
5-(2-prop-2-enyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 58575673) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 5-(2-prop-2-enyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-(2-prop-2-enyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 58575673 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 5-(2-prop-2-enyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C=CCn1nnc(C2=CCCNC2)n1 |
| InChI | InChI=1S/C9H13N5/c1-2-6-14-12-9(11-13-14)8-4-3-5-10-7-8/h2,4,10H,1,3,5-7H2 |
| InChIKey | FJXLPDZFRZJHOU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|