About (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene
(2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene (PubChem CID 58577289) has the molecular formula C6H8ClNO2
and a molecular weight of 161.59 g/mol. Its IUPAC name is (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene.
Molecular Properties
| Compound Name | (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene |
| PubChem CID | 58577289 |
| Molecular Formula | C6H8ClNO2 |
| Molecular Weight | 161.59 g/mol |
| Exact Mass | 161.02 |
| IUPAC Name | (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene |
| SMILES | C/C=C\C(=C(/C)Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C6H8ClNO2/c1-3-4-6(5(2)7)8(9)10/h3-4H,1-2H3/b4-3-,6-5- |
| InChIKey | ZAOXGSGIXIUGCQ-OUPQRBNQSA-N |
| XLogP | 2.31 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.59 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene?
The IUPAC name of (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene (CID 58577289) is (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene.
What is the SMILES notation for (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene?
The canonical SMILES for (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene is C/C=C\C(=C(/C)Cl)[N+](=O)[O-].
What is the InChIKey of (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene?
The InChIKey is ZAOXGSGIXIUGCQ-OUPQRBNQSA-N. The full InChI is InChI=1S/C6H8ClNO2/c1-3-4-6(5(2)7)8(9)10/h3-4H,1-2H3/b4-3-,6-5-.
What are the key properties of (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene?
(2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene has a molecular weight of 161.59 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-2-chloro-3-nitrohexa-2,4-diene is sourced from PubChem (CID 58577289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).