About (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine
(4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine (PubChem CID 58578233) has the molecular formula C10H20FN
and a molecular weight of 173.27 g/mol. Its IUPAC name is (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine.
Molecular Properties
| Compound Name | (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine |
| PubChem CID | 58578233 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.27 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine |
| SMILES | CC(C)C1C[C@H](F)CN1C(C)C |
| InChI | InChI=1S/C10H20FN/c1-7(2)10-5-9(11)6-12(10)8(3)4/h7-10H,5-6H2,1-4H3/t9-,10?/m0/s1 |
| InChIKey | CJHRDUTVDUDQTB-RGURZIINSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine?
The IUPAC name of (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine (CID 58578233) is (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine.
What is the SMILES notation for (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine?
The canonical SMILES for (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine is CC(C)C1C[C@H](F)CN1C(C)C.
What is the InChIKey of (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine?
The InChIKey is CJHRDUTVDUDQTB-RGURZIINSA-N. The full InChI is InChI=1S/C10H20FN/c1-7(2)10-5-9(11)6-12(10)8(3)4/h7-10H,5-6H2,1-4H3/t9-,10?/m0/s1.
What are the key properties of (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine?
(4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine has a molecular weight of 173.27 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-fluoro-1,2-di(propan-2-yl)pyrrolidine is sourced from PubChem (CID 58578233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).