C24H27ClFN5O4 — CID 58578481
N-[3-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]propyl]acetamide (PubChem CID 58578481) has the molecular formula C24H27ClFN5O4 and a molecular weight of 503.96 g/mol. Its IUPAC name is N-[3-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]propyl]acetamide.
| Compound Name | N-[3-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 58578481 |
| Molecular Formula | C24H27ClFN5O4 |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[3-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCn1c(=O)nc(Nc2ccc(OC(C)C)c(F)c2)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C24H27ClFN5O4/c1-15(2)35-21-10-9-19(13-20(21)26)28-22-29-23(33)30(12-4-11-27-16(3)32)24(34)31(22)14-17-5-7-18(25)8-6-17/h5-10,13,15H,4,11-12,14H2,1-3H3,(H,27,32)(H,28,29,33) |
| InChIKey | IFZZAWGUWRJMDO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|