C43H56N2O3S — CID 58579143
5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-3-[(8Z,11Z,14Z,17Z,20Z)-2-methylidenetricosa-8,11,14,17,20-pentaenyl]-1,3-thiazolidine-2,4-dione (PubChem CID 58579143) has the molecular formula C43H56N2O3S and a molecular weight of 681.00 g/mol. Its IUPAC name is 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-3-[(8Z,11Z,14Z,17Z,20Z)-2-methylidenetricosa-8,11,14,17,20-pentaenyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-3-[(8Z,11Z,14Z,17Z,20Z)-2-methylidenetricosa-8,11,14,17,20-pentaenyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58579143 |
| Molecular Formula | C43H56N2O3S |
| Molecular Weight | 681.00 g/mol |
| Exact Mass | 680.40 |
| IUPAC Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-3-[(8Z,11Z,14Z,17Z,20Z)-2-methylidenetricosa-8,11,14,17,20-pentaenyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C=C(CCCCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)CN1C(=O)SC(Cc2ccc(OCCc3ccc(CC)cn3)cc2)C1=O |
| InChI | InChI=1S/C43H56N2O3S/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-36(3)35-45-42(46)41(49-43(45)47)33-38-26-29-40(30-27-38)48-32-31-39-28-25-37(5-2)34-44-39/h6-7,9-10,12-13,15-16,18-19,25-30,34,41H,3-5,8,11,14,17,20-24,31-33,35H2,1-2H3/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | RSXHGCCVNABIHK-WMPRHZDHSA-N |
| XLogP | 11.13 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.00 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|