About 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine
3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine (PubChem CID 58579507) has the molecular formula C21H14BrF3N2O
and a molecular weight of 447.25 g/mol. Its IUPAC name is 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine.
Molecular Properties
| Compound Name | 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine |
| PubChem CID | 58579507 |
| Molecular Formula | C21H14BrF3N2O |
| Molecular Weight | 447.25 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine |
| SMILES | COc1cc(C2(c3cccc(Br)c3)N=C(N)c3c(F)cccc32)cc(F)c1F |
| InChI | InChI=1S/C21H14BrF3N2O/c1-28-17-10-12(9-16(24)19(17)25)21(11-4-2-5-13(22)8-11)14-6-3-7-15(23)18(14)20(26)27-21/h2-10H,1H3,(H2,26,27) |
| InChIKey | CXZAHYRFCGSOBZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine?
The IUPAC name of 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine (CID 58579507) is 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine.
What is the SMILES notation for 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine?
The canonical SMILES for 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine is COc1cc(C2(c3cccc(Br)c3)N=C(N)c3c(F)cccc32)cc(F)c1F.
What is the InChIKey of 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine?
The InChIKey is CXZAHYRFCGSOBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14BrF3N2O/c1-28-17-10-12(9-16(24)19(17)25)21(11-4-2-5-13(22)8-11)14-6-3-7-15(23)18(14)20(26)27-21/h2-10H,1H3,(H2,26,27).
What are the key properties of 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine?
3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine has a molecular weight of 447.25 g/mol, XLogP of 4.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine is sourced from PubChem (CID 58579507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).