About 3,6-ditert-butyl-2,3-dihydropyridine
3,6-ditert-butyl-2,3-dihydropyridine (PubChem CID 58579568) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 3,6-ditert-butyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 3,6-ditert-butyl-2,3-dihydropyridine |
| PubChem CID | 58579568 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 3,6-ditert-butyl-2,3-dihydropyridine |
| SMILES | CC(C)(C)C1=NCC(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C13H23N/c1-12(2,3)10-7-8-11(14-9-10)13(4,5)6/h7-8,10H,9H2,1-6H3 |
| InChIKey | JKBVXFMPLVWHHF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-ditert-butyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-ditert-butyl-2,3-dihydropyridine?
The IUPAC name of 3,6-ditert-butyl-2,3-dihydropyridine (CID 58579568) is 3,6-ditert-butyl-2,3-dihydropyridine.
What is the SMILES notation for 3,6-ditert-butyl-2,3-dihydropyridine?
The canonical SMILES for 3,6-ditert-butyl-2,3-dihydropyridine is CC(C)(C)C1=NCC(C(C)(C)C)C=C1.
What is the InChIKey of 3,6-ditert-butyl-2,3-dihydropyridine?
The InChIKey is JKBVXFMPLVWHHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-12(2,3)10-7-8-11(14-9-10)13(4,5)6/h7-8,10H,9H2,1-6H3.
What are the key properties of 3,6-ditert-butyl-2,3-dihydropyridine?
3,6-ditert-butyl-2,3-dihydropyridine has a molecular weight of 193.33 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-ditert-butyl-2,3-dihydropyridine is sourced from PubChem (CID 58579568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).