C27H26ClNO4S — CID 58579603
5-[4-(4-chloro-N-methylanilino)benzoyl]-2-cyclohexylsulfinylbenzoic acid (PubChem CID 58579603) has the molecular formula C27H26ClNO4S and a molecular weight of 496.03 g/mol. Its IUPAC name is 5-[4-(4-chloro-N-methylanilino)benzoyl]-2-cyclohexylsulfinylbenzoic acid.
| Compound Name | 5-[4-(4-chloro-N-methylanilino)benzoyl]-2-cyclohexylsulfinylbenzoic acid |
|---|---|
| PubChem CID | 58579603 |
| Molecular Formula | C27H26ClNO4S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 5-[4-(4-chloro-N-methylanilino)benzoyl]-2-cyclohexylsulfinylbenzoic acid |
| SMILES | CN(c1ccc(Cl)cc1)c1ccc(C(=O)c2ccc(S(=O)C3CCCCC3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H26ClNO4S/c1-29(22-14-10-20(28)11-15-22)21-12-7-18(8-13-21)26(30)19-9-16-25(24(17-19)27(31)32)34(33)23-5-3-2-4-6-23/h7-17,23H,2-6H2,1H3,(H,31,32) |
| InChIKey | WHGVAVVOYORPHM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |