About (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate
(2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 58579762) has the molecular formula C22H24FNS2
and a molecular weight of 385.57 g/mol. Its IUPAC name is (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| PubChem CID | 58579762 |
| Molecular Formula | C22H24FNS2 |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | CC1CCCCC1S/C(C=CSc1ccc(F)cc1)=N/c1ccccc1 |
| InChI | InChI=1S/C22H24FNS2/c1-17-7-5-6-10-21(17)26-22(24-19-8-3-2-4-9-19)15-16-25-20-13-11-18(23)12-14-20/h2-4,8-9,11-17,21H,5-7,10H2,1H3/b16-15?,24-22+ |
| InChIKey | OZJQTUIMARUTON-AODJLUEHSA-N |
| XLogP | 7.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The IUPAC name of (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (CID 58579762) is (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
What is the SMILES notation for (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The canonical SMILES for (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate is CC1CCCCC1S/C(C=CSc1ccc(F)cc1)=N/c1ccccc1.
What is the InChIKey of (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The InChIKey is OZJQTUIMARUTON-AODJLUEHSA-N. The full InChI is InChI=1S/C22H24FNS2/c1-17-7-5-6-10-21(17)26-22(24-19-8-3-2-4-9-19)15-16-25-20-13-11-18(23)12-14-20/h2-4,8-9,11-17,21H,5-7,10H2,1H3/b16-15?,24-22+.
What are the key properties of (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
(2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate has a molecular weight of 385.57 g/mol, XLogP of 7.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate is sourced from PubChem (CID 58579762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).