About 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate
1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 58579765) has the molecular formula C23H26FNS2
and a molecular weight of 399.60 g/mol. Its IUPAC name is 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
Molecular Properties
| Compound Name | 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| PubChem CID | 58579765 |
| Molecular Formula | C23H26FNS2 |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | CC(S/C(C=CSc1ccc(F)cc1)=N\c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C23H26FNS2/c1-18(19-8-4-2-5-9-19)27-23(25-21-10-6-3-7-11-21)16-17-26-22-14-12-20(24)13-15-22/h3,6-7,10-19H,2,4-5,8-9H2,1H3/b17-16?,25-23- |
| InChIKey | MSSKXHPZFWGTKS-AEFJEBGZSA-N |
| XLogP | 7.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The IUPAC name of 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (CID 58579765) is 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
What is the SMILES notation for 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The canonical SMILES for 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate is CC(S/C(C=CSc1ccc(F)cc1)=N\c1ccccc1)C1CCCCC1.
What is the InChIKey of 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The InChIKey is MSSKXHPZFWGTKS-AEFJEBGZSA-N. The full InChI is InChI=1S/C23H26FNS2/c1-18(19-8-4-2-5-9-19)27-23(25-21-10-6-3-7-11-21)16-17-26-22-14-12-20(24)13-15-22/h3,6-7,10-19H,2,4-5,8-9H2,1H3/b17-16?,25-23-.
What are the key properties of 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate has a molecular weight of 399.60 g/mol, XLogP of 7.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethyl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate is sourced from PubChem (CID 58579765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).