About cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate
cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate (PubChem CID 58579779) has the molecular formula C16H18FNS
and a molecular weight of 275.39 g/mol. Its IUPAC name is cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate.
Molecular Properties
| Compound Name | cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate |
| PubChem CID | 58579779 |
| Molecular Formula | C16H18FNS |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate |
| SMILES | C#C/C(=N\c1cccc(F)c1)SCC1CCCCC1 |
| InChI | InChI=1S/C16H18FNS/c1-2-16(18-15-10-6-9-14(17)11-15)19-12-13-7-4-3-5-8-13/h1,6,9-11,13H,3-5,7-8,12H2/b18-16+ |
| InChIKey | IAXWCEBWKNUVLC-FBMGVBCBSA-N |
| XLogP | 4.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate?
The IUPAC name of cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate (CID 58579779) is cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate.
What is the SMILES notation for cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate?
The canonical SMILES for cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate is C#C/C(=N\c1cccc(F)c1)SCC1CCCCC1.
What is the InChIKey of cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate?
The InChIKey is IAXWCEBWKNUVLC-FBMGVBCBSA-N. The full InChI is InChI=1S/C16H18FNS/c1-2-16(18-15-10-6-9-14(17)11-15)19-12-13-7-4-3-5-8-13/h1,6,9-11,13H,3-5,7-8,12H2/b18-16+.
What are the key properties of cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate?
cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate has a molecular weight of 275.39 g/mol, XLogP of 4.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl N-(3-fluorophenyl)prop-2-ynimidothioate is sourced from PubChem (CID 58579779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).