About 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate
5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 58579807) has the molecular formula C22H26FNS2
and a molecular weight of 387.59 g/mol. Its IUPAC name is 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
Molecular Properties
| Compound Name | 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| PubChem CID | 58579807 |
| Molecular Formula | C22H26FNS2 |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | CCC(CC(C)C)S/C(C=CSc1ccc(F)cc1)=N\c1ccccc1 |
| InChI | InChI=1S/C22H26FNS2/c1-4-20(16-17(2)3)26-22(24-19-8-6-5-7-9-19)14-15-25-21-12-10-18(23)11-13-21/h5-15,17,20H,4,16H2,1-3H3/b15-14?,24-22- |
| InChIKey | NMOXPVFJNRWFRY-UXBYOTHMSA-N |
| XLogP | 7.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The IUPAC name of 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (CID 58579807) is 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
What is the SMILES notation for 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The canonical SMILES for 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate is CCC(CC(C)C)S/C(C=CSc1ccc(F)cc1)=N\c1ccccc1.
What is the InChIKey of 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The InChIKey is NMOXPVFJNRWFRY-UXBYOTHMSA-N. The full InChI is InChI=1S/C22H26FNS2/c1-4-20(16-17(2)3)26-22(24-19-8-6-5-7-9-19)14-15-25-21-12-10-18(23)11-13-21/h5-15,17,20H,4,16H2,1-3H3/b15-14?,24-22-.
What are the key properties of 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate has a molecular weight of 387.59 g/mol, XLogP of 7.72, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate is sourced from PubChem (CID 58579807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).