About 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate
3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 58579812) has the molecular formula C23H28FNS2
and a molecular weight of 401.62 g/mol. Its IUPAC name is 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
Molecular Properties
| Compound Name | 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| PubChem CID | 58579812 |
| Molecular Formula | C23H28FNS2 |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | CCCC(S/C(C=CSc1ccc(F)cc1)=N\c1ccccc1)C(C)CC |
| InChI | InChI=1S/C23H28FNS2/c1-4-9-22(18(3)5-2)27-23(25-20-10-7-6-8-11-20)16-17-26-21-14-12-19(24)13-15-21/h6-8,10-18,22H,4-5,9H2,1-3H3/b17-16?,25-23- |
| InChIKey | VQLNTFAERUJIIG-AEFJEBGZSA-N |
| XLogP | 8.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The IUPAC name of 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (CID 58579812) is 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
What is the SMILES notation for 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The canonical SMILES for 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate is CCCC(S/C(C=CSc1ccc(F)cc1)=N\c1ccccc1)C(C)CC.
What is the InChIKey of 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
The InChIKey is VQLNTFAERUJIIG-AEFJEBGZSA-N. The full InChI is InChI=1S/C23H28FNS2/c1-4-9-22(18(3)5-2)27-23(25-20-10-7-6-8-11-20)16-17-26-21-14-12-19(24)13-15-21/h6-8,10-18,22H,4-5,9H2,1-3H3/b17-16?,25-23-.
What are the key properties of 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate?
3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate has a molecular weight of 401.62 g/mol, XLogP of 8.11, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptan-4-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate is sourced from PubChem (CID 58579812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).