About butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium
butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium (PubChem CID 58580009) has the molecular formula C27H36NO3+
and a molecular weight of 422.59 g/mol. Its IUPAC name is butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium.
Molecular Properties
| Compound Name | butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium |
| PubChem CID | 58580009 |
| Molecular Formula | C27H36NO3+ |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium |
| SMILES | CCCC[N+](C)(C)C1C2CCC1C(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C27H36NO3/c1-4-5-18-28(2,3)25-20-16-17-23(25)24(19-20)31-26(29)27(30,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,20,23-25,30H,4-5,16-19H2,1-3H3/q+1 |
| InChIKey | ZQYMUGXGJOHKDB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium?
The IUPAC name of butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium (CID 58580009) is butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium.
What is the SMILES notation for butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium?
The canonical SMILES for butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium is CCCC[N+](C)(C)C1C2CCC1C(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2.
What is the InChIKey of butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium?
The InChIKey is ZQYMUGXGJOHKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H36NO3/c1-4-5-18-28(2,3)25-20-16-17-23(25)24(19-20)31-26(29)27(30,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,20,23-25,30H,4-5,16-19H2,1-3H3/q+1.
What are the key properties of butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium?
butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium has a molecular weight of 422.59 g/mol, XLogP of 4.51, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium is sourced from PubChem (CID 58580009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).