C30H33N3O4S — CID 58580125
[5-(2,2-dimethylpropanoyloxy)-2-ethyl-4-(4-naphthalen-1-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl] 2,2-dimethylpropanoate (PubChem CID 58580125) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is [5-(2,2-dimethylpropanoyloxy)-2-ethyl-4-(4-naphthalen-1-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [5-(2,2-dimethylpropanoyloxy)-2-ethyl-4-(4-naphthalen-1-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58580125 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | [5-(2,2-dimethylpropanoyloxy)-2-ethyl-4-(4-naphthalen-1-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl] 2,2-dimethylpropanoate |
| SMILES | CCc1cc(-c2n[nH]c(=S)n2-c2cccc3ccccc23)c(OC(=O)C(C)(C)C)cc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H33N3O4S/c1-8-18-16-21(24(37-27(35)30(5,6)7)17-23(18)36-26(34)29(2,3)4)25-31-32-28(38)33(25)22-15-11-13-19-12-9-10-14-20(19)22/h9-17H,8H2,1-7H3,(H,32,38) |
| InChIKey | RWGXJFRSKNGJPF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|