C18H19F3N2O — CID 58580467
N'-methyl-2-phenylmethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide (PubChem CID 58580467) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is N'-methyl-2-phenylmethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide.
| Compound Name | N'-methyl-2-phenylmethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide |
|---|---|
| PubChem CID | 58580467 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N'-methyl-2-phenylmethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide |
| SMILES | C/N=C(\COCc1ccccc1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O/c1-22-17(13-24-12-15-5-3-2-4-6-15)23-11-14-7-9-16(10-8-14)18(19,20)21/h2-10H,11-13H2,1H3,(H,22,23) |
| InChIKey | XHSVYZJGAXNLKK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|