About 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene
3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene (PubChem CID 58581350) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene.
Molecular Properties
| Compound Name | 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene |
| PubChem CID | 58581350 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene |
| SMILES | CC1C=Cc2cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C14H16/c1-10-6-7-13-8-11-4-2-3-5-12(11)9-14(10)13/h6-10H,2-5H2,1H3 |
| InChIKey | YDPFUXXNOATVOR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene?
The IUPAC name of 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene (CID 58581350) is 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene.
What is the SMILES notation for 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene?
The canonical SMILES for 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene is CC1C=Cc2cc3c(cc21)CCCC3.
What is the InChIKey of 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene?
The InChIKey is YDPFUXXNOATVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16/c1-10-6-7-13-8-11-4-2-3-5-12(11)9-14(10)13/h6-10H,2-5H2,1H3.
What are the key properties of 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene?
3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene has a molecular weight of 184.28 g/mol, XLogP of 3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6,7,8-tetrahydro-3H-cyclopenta[b]naphthalene is sourced from PubChem (CID 58581350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).