About [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate
[(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate (PubChem CID 58581813) has the molecular formula C24H21FO6S2
and a molecular weight of 488.56 g/mol. Its IUPAC name is [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate.
Molecular Properties
| Compound Name | [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate |
| PubChem CID | 58581813 |
| Molecular Formula | C24H21FO6S2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](/C=C/c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21FO6S2/c1-19(26)31-23(18-17-20-11-5-2-6-12-20)24(25,32(27,28)21-13-7-3-8-14-21)33(29,30)22-15-9-4-10-16-22/h2-18,23H,1H3/b18-17+/t23-/m0/s1 |
| InChIKey | JHWVDFAQDYTALT-SQAMQDMYSA-N |
| XLogP | 4.20 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate?
The IUPAC name of [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate (CID 58581813) is [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate.
What is the SMILES notation for [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate?
The canonical SMILES for [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate is CC(=O)O[C@@H](/C=C/c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate?
The InChIKey is JHWVDFAQDYTALT-SQAMQDMYSA-N. The full InChI is InChI=1S/C24H21FO6S2/c1-19(26)31-23(18-17-20-11-5-2-6-12-20)24(25,32(27,28)21-13-7-3-8-14-21)33(29,30)22-15-9-4-10-16-22/h2-18,23H,1H3/b18-17+/t23-/m0/s1.
What are the key properties of [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate?
[(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate has a molecular weight of 488.56 g/mol, XLogP of 4.20, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2S)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-yl] acetate is sourced from PubChem (CID 58581813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).