C33H27F9N6O9 — CID 58582703
1,3,5-tris[2-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 58582703) has the molecular formula C33H27F9N6O9 and a molecular weight of 822.59 g/mol. Its IUPAC name is 1,3,5-tris[2-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[2-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 58582703 |
| Molecular Formula | C33H27F9N6O9 |
| Molecular Weight | 822.59 g/mol |
| Exact Mass | 822.17 |
| IUPAC Name | 1,3,5-tris[2-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CCOc2ccc(C(=NO)C(F)(F)F)cc2)c(=O)n(CCOc2ccc(C(=NO)C(F)(F)F)cc2)c(=O)n1CCOc1ccc(C(=NO)C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H27F9N6O9/c34-31(35,36)25(43-52)19-1-7-22(8-2-19)55-16-13-46-28(49)47(14-17-56-23-9-3-20(4-10-23)26(44-53)32(37,38)39)30(51)48(29(46)50)15-18-57-24-11-5-21(6-12-24)27(45-54)33(40,41)42/h1-12,52-54H,13-18H2 |
| InChIKey | CKZAHBNERFLHDD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 191.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|