C21H27N3O4S — CID 58582722
(2S,3R)-N,2-dihydroxy-3-[(2S)-2-(4-phenyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]heptanamide (PubChem CID 58582722) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is (2S,3R)-N,2-dihydroxy-3-[(2S)-2-(4-phenyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]heptanamide.
| Compound Name | (2S,3R)-N,2-dihydroxy-3-[(2S)-2-(4-phenyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]heptanamide |
|---|---|
| PubChem CID | 58582722 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (2S,3R)-N,2-dihydroxy-3-[(2S)-2-(4-phenyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]heptanamide |
| SMILES | CCCC[C@@H](C(=O)N1CCC[C@H]1c1nc(-c2ccccc2)cs1)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C21H27N3O4S/c1-2-3-10-15(18(25)19(26)23-28)21(27)24-12-7-11-17(24)20-22-16(13-29-20)14-8-5-4-6-9-14/h4-6,8-9,13,15,17-18,25,28H,2-3,7,10-12H2,1H3,(H,23,26)/t15-,17+,18+/m1/s1 |
| InChIKey | KUQNAXBQTGNWIH-NJAFHUGGSA-N |
| XLogP | 3.15 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|