C26H32FN3O3S — CID 58582781
N-[[4-[[[(3aR,9bS)-7-hydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide (PubChem CID 58582781) has the molecular formula C26H32FN3O3S and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[[4-[[[(3aR,9bS)-7-hydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[[4-[[[(3aR,9bS)-7-hydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 58582781 |
| Molecular Formula | C26H32FN3O3S |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-[[4-[[[(3aR,9bS)-7-hydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC(CNC2=N[C@@H]3CCc4cc(O)ccc4[C@@H]3C2)CC1)c1ccccc1F |
| InChI | InChI=1S/C26H32FN3O3S/c27-23-3-1-2-4-25(23)34(32,33)29-16-18-7-5-17(6-8-18)15-28-26-14-22-21-11-10-20(31)13-19(21)9-12-24(22)30-26/h1-4,10-11,13,17-18,22,24,29,31H,5-9,12,14-16H2,(H,28,30)/t17?,18?,22-,24+/m0/s1 |
| InChIKey | QZYPOAXMHUMEHO-BYSKWZFGSA-N |
| XLogP | 4.11 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |