C26H32FN3O4S — CID 58582802
N-[[4-[[[(3aR,9bS)-7,8-dihydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide (PubChem CID 58582802) has the molecular formula C26H32FN3O4S and a molecular weight of 501.62 g/mol. Its IUPAC name is N-[[4-[[[(3aR,9bS)-7,8-dihydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[[4-[[[(3aR,9bS)-7,8-dihydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 58582802 |
| Molecular Formula | C26H32FN3O4S |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | N-[[4-[[[(3aR,9bS)-7,8-dihydroxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-yl]amino]methyl]cyclohexyl]methyl]-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC(CNC2=N[C@@H]3CCc4cc(O)c(O)cc4[C@@H]3C2)CC1)c1ccccc1F |
| InChI | InChI=1S/C26H32FN3O4S/c27-21-3-1-2-4-25(21)35(33,34)29-15-17-7-5-16(6-8-17)14-28-26-13-20-19-12-24(32)23(31)11-18(19)9-10-22(20)30-26/h1-4,11-12,16-17,20,22,29,31-32H,5-10,13-15H2,(H,28,30)/t16?,17?,20-,22+/m0/s1 |
| InChIKey | DLDIYCGMRIGKFF-MPPJEYDWSA-N |
| XLogP | 3.81 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|