About acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+)
acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+) (PubChem CID 58582874) has the molecular formula C9H16NORb
and a molecular weight of 239.70 g/mol. Its IUPAC name is acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+).
Molecular Properties
| Compound Name | acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+) |
| PubChem CID | 58582874 |
| Molecular Formula | C9H16NORb |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+) |
| SMILES | CC(=O)[N-]C(C)C(C)=C(C)C.[Rb+] |
| InChI | InChI=1S/C9H17NO.Rb/c1-6(2)7(3)8(4)10-9(5)11;/h8H,1-5H3,(H,10,11);/q;+1/p-1 |
| InChIKey | MDVORWFJCSGHLO-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+)?
The IUPAC name of acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+) (CID 58582874) is acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+).
What is the SMILES notation for acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+)?
The canonical SMILES for acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+) is CC(=O)[N-]C(C)C(C)=C(C)C.[Rb+].
What is the InChIKey of acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+)?
The InChIKey is MDVORWFJCSGHLO-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H17NO.Rb/c1-6(2)7(3)8(4)10-9(5)11;/h8H,1-5H3,(H,10,11);/q;+1/p-1.
What are the key properties of acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+)?
acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+) has a molecular weight of 239.70 g/mol, XLogP of -0.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl(3,4-dimethylpent-3-en-2-yl)azanide;rubidium(1+) is sourced from PubChem (CID 58582874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).