C22H26Cl2FNO4S — CID 58582895
[(2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)hexan-3-yl] butanoate (PubChem CID 58582895) has the molecular formula C22H26Cl2FNO4S and a molecular weight of 490.42 g/mol. Its IUPAC name is [(2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)hexan-3-yl] butanoate.
| Compound Name | [(2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)hexan-3-yl] butanoate |
|---|---|
| PubChem CID | 58582895 |
| Molecular Formula | C22H26Cl2FNO4S |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | [(2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)hexan-3-yl] butanoate |
| SMILES | CCCC(=O)OC(CCC)[C@@H](C)N(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26Cl2FNO4S/c1-4-6-21(30-22(27)7-5-2)15(3)26(20-14-17(24)10-13-19(20)25)31(28,29)18-11-8-16(23)9-12-18/h8-15,21H,4-7H2,1-3H3/t15-,21?/m1/s1 |
| InChIKey | ITZFGEMDAKFDCN-RBFZIWAESA-N |
| XLogP | 6.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |