C21H36O3 — CID 58582995
(4S,7R,8S,9R,13Z)-16-deuterio-4,5,5,7,8,9-hexamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 58582995) has the molecular formula C21H36O3 and a molecular weight of 337.52 g/mol. Its IUPAC name is (4S,7R,8S,9R,13Z)-16-deuterio-4,5,5,7,8,9-hexamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9R,13Z)-16-deuterio-4,5,5,7,8,9-hexamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 58582995 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 337.52 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | (4S,7R,8S,9R,13Z)-16-deuterio-4,5,5,7,8,9-hexamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | [2H]C1C/C=C\CCC[C@@H](C)[C@H](C)[C@@H](C)C(=O)C(C)(C)[C@@H](C)CC(=O)O1 |
| InChI | InChI=1S/C21H36O3/c1-15-12-10-8-7-9-11-13-24-19(22)14-16(2)21(5,6)20(23)18(4)17(15)3/h7,9,15-18H,8,10-14H2,1-6H3/b9-7-/t15-,16+,17+,18-/m1/s1/i13D/t13?,15-,16+,17+,18- |
| InChIKey | ARHOSOFYGSBRPI-BQYUBJTHSA-N |
| XLogP | 5.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|