C35H36NO4P — CID 58583038
(3aR,8aR)-N,N-dimethyl-4,4,8,8-tetraphenylspiro[3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine-2,1'-cyclopentane]-6-amine (PubChem CID 58583038) has the molecular formula C35H36NO4P and a molecular weight of 565.65 g/mol. Its IUPAC name is (3aR,8aR)-N,N-dimethyl-4,4,8,8-tetraphenylspiro[3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine-2,1'-cyclopentane]-6-amine.
| Compound Name | (3aR,8aR)-N,N-dimethyl-4,4,8,8-tetraphenylspiro[3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine-2,1'-cyclopentane]-6-amine |
|---|---|
| PubChem CID | 58583038 |
| Molecular Formula | C35H36NO4P |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | (3aR,8aR)-N,N-dimethyl-4,4,8,8-tetraphenylspiro[3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine-2,1'-cyclopentane]-6-amine |
| SMILES | CN(C)P1OC(c2ccccc2)(c2ccccc2)[C@@H]2OC3(CCCC3)O[C@H]2C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C35H36NO4P/c1-36(2)41-39-34(27-17-7-3-8-18-27,28-19-9-4-10-20-28)31-32(38-33(37-31)25-15-16-26-33)35(40-41,29-21-11-5-12-22-29)30-23-13-6-14-24-30/h3-14,17-24,31-32H,15-16,25-26H2,1-2H3/t31-,32-/m1/s1 |
| InChIKey | NBJMKQWOLOLNTN-ROJLCIKYSA-N |
| XLogP | 7.76 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|