C26H28Cl2FN3O — CID 58583369
5-(2,4-dichlorophenyl)-3,6-diethyl-N-[(1R,2S)-2-(3-fluoropropoxy)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine (PubChem CID 58583369) has the molecular formula C26H28Cl2FN3O and a molecular weight of 488.43 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3,6-diethyl-N-[(1R,2S)-2-(3-fluoropropoxy)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine.
| Compound Name | 5-(2,4-dichlorophenyl)-3,6-diethyl-N-[(1R,2S)-2-(3-fluoropropoxy)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 58583369 |
| Molecular Formula | C26H28Cl2FN3O |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3,6-diethyl-N-[(1R,2S)-2-(3-fluoropropoxy)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine |
| SMILES | CCc1nc(-c2ccc(Cl)cc2Cl)c(CC)nc1N[C@@H]1c2ccccc2C[C@@H]1OCCCF |
| InChI | InChI=1S/C26H28Cl2FN3O/c1-3-21-24(19-11-10-17(27)15-20(19)28)30-22(4-2)26(31-21)32-25-18-9-6-5-8-16(18)14-23(25)33-13-7-12-29/h5-6,8-11,15,23,25H,3-4,7,12-14H2,1-2H3,(H,31,32)/t23-,25+/m0/s1 |
| InChIKey | BPRMHHFNAYDYTJ-UKILVPOCSA-N |
| XLogP | 7.03 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|