C22H27ClFN3O4 — CID 58583504
(3S,4R)-3-[[5-(2-chloro-4-methoxyphenyl)-3,6-diethylpyrazin-2-yl]amino]-4-(3-fluoropropoxy)oxolan-2-one (PubChem CID 58583504) has the molecular formula C22H27ClFN3O4 and a molecular weight of 451.93 g/mol. Its IUPAC name is (3S,4R)-3-[[5-(2-chloro-4-methoxyphenyl)-3,6-diethylpyrazin-2-yl]amino]-4-(3-fluoropropoxy)oxolan-2-one.
| Compound Name | (3S,4R)-3-[[5-(2-chloro-4-methoxyphenyl)-3,6-diethylpyrazin-2-yl]amino]-4-(3-fluoropropoxy)oxolan-2-one |
|---|---|
| PubChem CID | 58583504 |
| Molecular Formula | C22H27ClFN3O4 |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (3S,4R)-3-[[5-(2-chloro-4-methoxyphenyl)-3,6-diethylpyrazin-2-yl]amino]-4-(3-fluoropropoxy)oxolan-2-one |
| SMILES | CCc1nc(-c2ccc(OC)cc2Cl)c(CC)nc1N[C@@H]1C(=O)OC[C@@H]1OCCCF |
| InChI | InChI=1S/C22H27ClFN3O4/c1-4-16-19(14-8-7-13(29-3)11-15(14)23)25-17(5-2)21(26-16)27-20-18(12-31-22(20)28)30-10-6-9-24/h7-8,11,18,20H,4-6,9-10,12H2,1-3H3,(H,26,27)/t18-,20-/m0/s1 |
| InChIKey | BYUPKVSAVLGLLL-ICSRJNTNSA-N |
| XLogP | 4.01 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|